C10H13NO3 — CID 116872063
2-[3-(1H-pyrrol-2-yl)oxetan-3-yl]propanoic acid (PubChem CID 116872063) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-[3-(1H-pyrrol-2-yl)oxetan-3-yl]propanoic acid.
| Compound Name | 2-[3-(1H-pyrrol-2-yl)oxetan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 116872063 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-[3-(1H-pyrrol-2-yl)oxetan-3-yl]propanoic acid |
| SMILES | CC(C(=O)O)C1(c2ccc[nH]2)COC1 |
| InChI | InChI=1S/C10H13NO3/c1-7(9(12)13)10(5-14-6-10)8-3-2-4-11-8/h2-4,7,11H,5-6H2,1H3,(H,12,13) |
| InChIKey | PBGTWVMKWIUTOG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |