2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid

C13H13NO5 — CID 116872084

IUPAC2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid
SMILESCC(C(=O)O)C1(c2ccc3oc(=O)[nH]c3c2)COC1
InChIInChI=1S/C13H13NO5/c1-7(11(15)16)13(5-18-6-13)8-2-3-10-9(4-8)14-12(17)19-10/h2-4,7H,5-6H2,1H3,(H,14,17)(H,15,16)
InChIKeyQSWZCHIIQBFTCR-UHFFFAOYSA-N
MW263.25 g/mol
LogP1.11
Rot. Bonds3

About 2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid

2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid (PubChem CID 116872084) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is 2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid.

Molecular Properties

Compound Name2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid
PubChem CID116872084
Molecular FormulaC13H13NO5
Molecular Weight263.25 g/mol
Exact Mass263.08
IUPAC Name2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid
SMILESCC(C(=O)O)C1(c2ccc3oc(=O)[nH]c3c2)COC1
InChIInChI=1S/C13H13NO5/c1-7(11(15)16)13(5-18-6-13)8-2-3-10-9(4-8)14-12(17)19-10/h2-4,7H,5-6H2,1H3,(H,14,17)(H,15,16)
InChIKeyQSWZCHIIQBFTCR-UHFFFAOYSA-N
XLogP1.11
TPSA92.53 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.25
LogP ≤ 51.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid?
The IUPAC name of 2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid (CID 116872084) is 2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid.
What is the SMILES notation for 2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid?
The canonical SMILES for 2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid is CC(C(=O)O)C1(c2ccc3oc(=O)[nH]c3c2)COC1.
What is the InChIKey of 2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid?
The InChIKey is QSWZCHIIQBFTCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5/c1-7(11(15)16)13(5-18-6-13)8-2-3-10-9(4-8)14-12(17)19-10/h2-4,7H,5-6H2,1H3,(H,14,17)(H,15,16).
What are the key properties of 2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid?
2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid has a molecular weight of 263.25 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid is sourced from PubChem (CID 116872084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).