3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid

C13H13NO5 — CID 116871960

IUPAC3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid
SMILESO=C(O)CCC1(c2ccc3oc(=O)[nH]c3c2)COC1
InChIInChI=1S/C13H13NO5/c15-11(16)3-4-13(6-18-7-13)8-1-2-10-9(5-8)14-12(17)19-10/h1-2,5H,3-4,6-7H2,(H,14,17)(H,15,16)
InChIKeyIANYUVGRXGJVDI-UHFFFAOYSA-N
MW263.25 g/mol
LogP1.25
Rot. Bonds4

About 3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid

3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid (PubChem CID 116871960) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid.

Molecular Properties

Compound Name3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid
PubChem CID116871960
Molecular FormulaC13H13NO5
Molecular Weight263.25 g/mol
Exact Mass263.08
IUPAC Name3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid
SMILESO=C(O)CCC1(c2ccc3oc(=O)[nH]c3c2)COC1
InChIInChI=1S/C13H13NO5/c15-11(16)3-4-13(6-18-7-13)8-1-2-10-9(5-8)14-12(17)19-10/h1-2,5H,3-4,6-7H2,(H,14,17)(H,15,16)
InChIKeyIANYUVGRXGJVDI-UHFFFAOYSA-N
XLogP1.25
TPSA92.53 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.25
LogP ≤ 51.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid?
The IUPAC name of 3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid (CID 116871960) is 3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid.
What is the SMILES notation for 3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid?
The canonical SMILES for 3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid is O=C(O)CCC1(c2ccc3oc(=O)[nH]c3c2)COC1.
What is the InChIKey of 3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid?
The InChIKey is IANYUVGRXGJVDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5/c15-11(16)3-4-13(6-18-7-13)8-1-2-10-9(5-8)14-12(17)19-10/h1-2,5H,3-4,6-7H2,(H,14,17)(H,15,16).
What are the key properties of 3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid?
3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid has a molecular weight of 263.25 g/mol, XLogP of 1.25, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-oxo-3H-1,3-benzoxazol-5-yl)oxetan-3-yl]propanoic acid is sourced from PubChem (CID 116871960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).