C26H26N2O3S — CID 1168721
4-methyl-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 1168721) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is 4-methyl-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1168721 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 4-methyl-N-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCc2ccccc2)Cc2cc3cc(C)ccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C26H26N2O3S/c1-19-8-11-24(12-9-19)32(30,31)28(15-14-21-6-4-3-5-7-21)18-23-17-22-16-20(2)10-13-25(22)27-26(23)29/h3-13,16-17H,14-15,18H2,1-2H3,(H,27,29) |
| InChIKey | LWUNCXNOIFGAAX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |