C27H28N2O3S — CID 1168647
N-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-[2-(3-methylphenyl)ethyl]benzenesulfonamide (PubChem CID 1168647) has the molecular formula C27H28N2O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is N-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-[2-(3-methylphenyl)ethyl]benzenesulfonamide.
| Compound Name | N-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-[2-(3-methylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1168647 |
| Molecular Formula | C27H28N2O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | N-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-N-[2-(3-methylphenyl)ethyl]benzenesulfonamide |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(CCc3cccc(C)c3)S(=O)(=O)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C27H28N2O3S/c1-3-21-12-13-26-23(17-21)18-24(27(30)28-26)19-29(15-14-22-9-7-8-20(2)16-22)33(31,32)25-10-5-4-6-11-25/h4-13,16-18H,3,14-15,19H2,1-2H3,(H,28,30) |
| InChIKey | VAXFFFMZHFKZKA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |