C20H21FN2O4S — CID 1161906
N-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-4-fluoro-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 1161906) has the molecular formula C20H21FN2O4S and a molecular weight of 404.46 g/mol. Its IUPAC name is N-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-4-fluoro-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | N-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-4-fluoro-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1161906 |
| Molecular Formula | C20H21FN2O4S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-4-fluoro-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(CCO)S(=O)(=O)c3ccc(F)cc3)cc2c1 |
| InChI | InChI=1S/C20H21FN2O4S/c1-2-14-3-8-19-15(11-14)12-16(20(25)22-19)13-23(9-10-24)28(26,27)18-6-4-17(21)5-7-18/h3-8,11-12,24H,2,9-10,13H2,1H3,(H,22,25) |
| InChIKey | JPJJNAHPJXMGKM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |