C22H24N2O6S — CID 1161692
ethyl 4-[2-hydroxyethyl-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]sulfamoyl]benzoate (PubChem CID 1161692) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is ethyl 4-[2-hydroxyethyl-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]sulfamoyl]benzoate.
| Compound Name | ethyl 4-[2-hydroxyethyl-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 1161692 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | ethyl 4-[2-hydroxyethyl-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N(CCO)Cc2cc3ccc(C)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C22H24N2O6S/c1-3-30-22(27)16-6-8-19(9-7-16)31(28,29)24(10-11-25)14-18-13-17-5-4-15(2)12-20(17)23-21(18)26/h4-9,12-13,25H,3,10-11,14H2,1-2H3,(H,23,26) |
| InChIKey | KFSUOSXVNHSLDK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |