C23H26N2O6S — CID 3183836
ethyl 4-[3-hydroxypropyl-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]sulfamoyl]benzoate (PubChem CID 3183836) has the molecular formula C23H26N2O6S and a molecular weight of 458.54 g/mol. Its IUPAC name is ethyl 4-[3-hydroxypropyl-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]sulfamoyl]benzoate.
| Compound Name | ethyl 4-[3-hydroxypropyl-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 3183836 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | ethyl 4-[3-hydroxypropyl-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N(CCCO)Cc2cc3ccc(C)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H26N2O6S/c1-3-31-23(28)17-7-9-20(10-8-17)32(29,30)25(11-4-12-26)15-19-14-18-6-5-16(2)13-21(18)24-22(19)27/h5-10,13-14,26H,3-4,11-12,15H2,1-2H3,(H,24,27) |
| InChIKey | HCCBYOFUHBMDPP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |