C20H21BrN2O5S — CID 1165278
4-bromo-N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 1165278) has the molecular formula C20H21BrN2O5S and a molecular weight of 481.37 g/mol. Its IUPAC name is 4-bromo-N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1165278 |
| Molecular Formula | C20H21BrN2O5S |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 4-bromo-N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CCO)S(=O)(=O)c3ccc(Br)cc3)cc2c1 |
| InChI | InChI=1S/C20H21BrN2O5S/c1-2-28-17-5-8-19-14(12-17)11-15(20(25)22-19)13-23(9-10-24)29(26,27)18-6-3-16(21)4-7-18/h3-8,11-12,24H,2,9-10,13H2,1H3,(H,22,25) |
| InChIKey | GUAZIEYKHYWQTG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |