C28H28N2O5S — CID 3184164
3-acetyl-N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 3184164) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is 3-acetyl-N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | 3-acetyl-N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3184164 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 3-acetyl-N-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CCc3ccccc3)S(=O)(=O)c3cccc(C(C)=O)c3)cc2c1 |
| InChI | InChI=1S/C28H28N2O5S/c1-3-35-25-12-13-27-23(17-25)16-24(28(32)29-27)19-30(15-14-21-8-5-4-6-9-21)36(33,34)26-11-7-10-22(18-26)20(2)31/h4-13,16-18H,3,14-15,19H2,1-2H3,(H,29,32) |
| InChIKey | LJESELYMFVXJJA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |