C12H12O4 — CID 116872410
3-(6-methyl-1,3-benzodioxol-5-yl)oxetane-3-carbaldehyde (PubChem CID 116872410) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is 3-(6-methyl-1,3-benzodioxol-5-yl)oxetane-3-carbaldehyde.
| Compound Name | 3-(6-methyl-1,3-benzodioxol-5-yl)oxetane-3-carbaldehyde |
|---|---|
| PubChem CID | 116872410 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 3-(6-methyl-1,3-benzodioxol-5-yl)oxetane-3-carbaldehyde |
| SMILES | Cc1cc2c(cc1C1(C=O)COC1)OCO2 |
| InChI | InChI=1S/C12H12O4/c1-8-2-10-11(16-7-15-10)3-9(8)12(4-13)5-14-6-12/h2-4H,5-7H2,1H3 |
| InChIKey | AIEGZFRZEQCRKX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|