C13H18O2S — CID 116872512
[3-(4-methoxy-3,5-dimethylphenyl)oxetan-3-yl]methanethiol (PubChem CID 116872512) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is [3-(4-methoxy-3,5-dimethylphenyl)oxetan-3-yl]methanethiol.
| Compound Name | [3-(4-methoxy-3,5-dimethylphenyl)oxetan-3-yl]methanethiol |
|---|---|
| PubChem CID | 116872512 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | [3-(4-methoxy-3,5-dimethylphenyl)oxetan-3-yl]methanethiol |
| SMILES | COc1c(C)cc(C2(CS)COC2)cc1C |
| InChI | InChI=1S/C13H18O2S/c1-9-4-11(5-10(2)12(9)14-3)13(8-16)6-15-7-13/h4-5,16H,6-8H2,1-3H3 |
| InChIKey | SYNKVYRJVCPWDH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|