C16H24OS — CID 116872471
[3-(4-tert-butyl-2,6-dimethylphenyl)oxetan-3-yl]methanethiol (PubChem CID 116872471) has the molecular formula C16H24OS and a molecular weight of 264.43 g/mol. Its IUPAC name is [3-(4-tert-butyl-2,6-dimethylphenyl)oxetan-3-yl]methanethiol.
| Compound Name | [3-(4-tert-butyl-2,6-dimethylphenyl)oxetan-3-yl]methanethiol |
|---|---|
| PubChem CID | 116872471 |
| Molecular Formula | C16H24OS |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | [3-(4-tert-butyl-2,6-dimethylphenyl)oxetan-3-yl]methanethiol |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C1(CS)COC1 |
| InChI | InChI=1S/C16H24OS/c1-11-6-13(15(3,4)5)7-12(2)14(11)16(10-18)8-17-9-16/h6-7,18H,8-10H2,1-5H3 |
| InChIKey | MLIMHBUKNPOOJU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|