C16H22N2O — CID 116875329
2-[3-(1-methylindol-3-yl)oxetan-3-yl]butan-1-amine (PubChem CID 116875329) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-[3-(1-methylindol-3-yl)oxetan-3-yl]butan-1-amine.
| Compound Name | 2-[3-(1-methylindol-3-yl)oxetan-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 116875329 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-[3-(1-methylindol-3-yl)oxetan-3-yl]butan-1-amine |
| SMILES | CCC(CN)C1(c2cn(C)c3ccccc23)COC1 |
| InChI | InChI=1S/C16H22N2O/c1-3-12(8-17)16(10-19-11-16)14-9-18(2)15-7-5-4-6-13(14)15/h4-7,9,12H,3,8,10-11,17H2,1-2H3 |
| InChIKey | IGPAINRZSZVWSG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |