C15H18O2S — CID 116875298
2-[3-(1-benzothiophen-3-yl)oxetan-3-yl]butan-1-ol (PubChem CID 116875298) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-[3-(1-benzothiophen-3-yl)oxetan-3-yl]butan-1-ol.
| Compound Name | 2-[3-(1-benzothiophen-3-yl)oxetan-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 116875298 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-[3-(1-benzothiophen-3-yl)oxetan-3-yl]butan-1-ol |
| SMILES | CCC(CO)C1(c2csc3ccccc23)COC1 |
| InChI | InChI=1S/C15H18O2S/c1-2-11(7-16)15(9-17-10-15)13-8-18-14-6-4-3-5-12(13)14/h3-6,8,11,16H,2,7,9-10H2,1H3 |
| InChIKey | YBHJGBZEHAJJKK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |