C17H24NOS+ — CID 6984428
4-(1-benzothiophen-3-yl)-2,2,6,6-tetramethylpiperidin-1-ium-4-ol (PubChem CID 6984428) has the molecular formula C17H24NOS+ and a molecular weight of 290.45 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-yl)-2,2,6,6-tetramethylpiperidin-1-ium-4-ol.
| Compound Name | 4-(1-benzothiophen-3-yl)-2,2,6,6-tetramethylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 6984428 |
| Molecular Formula | C17H24NOS+ |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 4-(1-benzothiophen-3-yl)-2,2,6,6-tetramethylpiperidin-1-ium-4-ol |
| SMILES | CC1(C)CC(O)(c2csc3ccccc23)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C17H23NOS/c1-15(2)10-17(19,11-16(3,4)18-15)13-9-20-14-8-6-5-7-12(13)14/h5-9,18-19H,10-11H2,1-4H3/p+1 |
| InChIKey | CYWFHHWNHJOSGH-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |