C17H22O2S — CID 65149267
4-(1-benzothiophen-3-ylmethyl)-2-ethyl-2-methyloxan-4-ol (PubChem CID 65149267) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-ylmethyl)-2-ethyl-2-methyloxan-4-ol.
| Compound Name | 4-(1-benzothiophen-3-ylmethyl)-2-ethyl-2-methyloxan-4-ol |
|---|---|
| PubChem CID | 65149267 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-(1-benzothiophen-3-ylmethyl)-2-ethyl-2-methyloxan-4-ol |
| SMILES | CCC1(C)CC(O)(Cc2csc3ccccc23)CCO1 |
| InChI | InChI=1S/C17H22O2S/c1-3-16(2)12-17(18,8-9-19-16)10-13-11-20-15-7-5-4-6-14(13)15/h4-7,11,18H,3,8-10,12H2,1-2H3 |
| InChIKey | OAAACCLIRVBEGW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |