C23H24O2S — CID 162403468
(1R,2R,5R)-2-(1-benzothiophen-3-ylmethyl)-2-hydroxy-4,4-dimethyl-5-phenylcyclopentane-1-carbaldehyde (PubChem CID 162403468) has the molecular formula C23H24O2S and a molecular weight of 364.51 g/mol. Its IUPAC name is (1R,2R,5R)-2-(1-benzothiophen-3-ylmethyl)-2-hydroxy-4,4-dimethyl-5-phenylcyclopentane-1-carbaldehyde.
| Compound Name | (1R,2R,5R)-2-(1-benzothiophen-3-ylmethyl)-2-hydroxy-4,4-dimethyl-5-phenylcyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 162403468 |
| Molecular Formula | C23H24O2S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (1R,2R,5R)-2-(1-benzothiophen-3-ylmethyl)-2-hydroxy-4,4-dimethyl-5-phenylcyclopentane-1-carbaldehyde |
| SMILES | CC1(C)C[C@@](O)(Cc2csc3ccccc23)[C@H](C=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H24O2S/c1-22(2)15-23(25,12-17-14-26-20-11-7-6-10-18(17)20)19(13-24)21(22)16-8-4-3-5-9-16/h3-11,13-14,19,21,25H,12,15H2,1-2H3/t19-,21-,23+/m1/s1 |
| InChIKey | IJZGUHUVPKACIL-LSWJPFSZSA-N |
| XLogP | 5.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|