C15H20N2S — CID 116856563
2-(1-benzothiophen-3-yl)-1,2,4-trimethylpiperazine (PubChem CID 116856563) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-1,2,4-trimethylpiperazine.
| Compound Name | 2-(1-benzothiophen-3-yl)-1,2,4-trimethylpiperazine |
|---|---|
| PubChem CID | 116856563 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-1,2,4-trimethylpiperazine |
| SMILES | CN1CCN(C)C(C)(c2csc3ccccc23)C1 |
| InChI | InChI=1S/C15H20N2S/c1-15(11-16(2)8-9-17(15)3)13-10-18-14-7-5-4-6-12(13)14/h4-7,10H,8-9,11H2,1-3H3 |
| InChIKey | FTNCDPBVYMSRPZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |