C16H20BrNS — CID 112747313
1-(1-benzothiophen-3-ylmethyl)-4-bromo-3,3-dimethylpiperidine (PubChem CID 112747313) has the molecular formula C16H20BrNS and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-ylmethyl)-4-bromo-3,3-dimethylpiperidine.
| Compound Name | 1-(1-benzothiophen-3-ylmethyl)-4-bromo-3,3-dimethylpiperidine |
|---|---|
| PubChem CID | 112747313 |
| Molecular Formula | C16H20BrNS |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 1-(1-benzothiophen-3-ylmethyl)-4-bromo-3,3-dimethylpiperidine |
| SMILES | CC1(C)CN(Cc2csc3ccccc23)CCC1Br |
| InChI | InChI=1S/C16H20BrNS/c1-16(2)11-18(8-7-15(16)17)9-12-10-19-14-6-4-3-5-13(12)14/h3-6,10,15H,7-9,11H2,1-2H3 |
| InChIKey | LHYYMGSWAMBZAV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|