About (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine
(3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine (PubChem CID 126704852) has the molecular formula C14H17NS
and a molecular weight of 231.36 g/mol. Its IUPAC name is (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine |
| PubChem CID | 126704852 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine |
| SMILES | CN1CC[C@@](C)(c2cc3ccccc3s2)C1 |
| InChI | InChI=1S/C14H17NS/c1-14(7-8-15(2)10-14)13-9-11-5-3-4-6-12(11)16-13/h3-6,9H,7-8,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | GRBXYCWHHUSDDI-CQSZACIVSA-N |
| XLogP | 3.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine?
The IUPAC name of (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine (CID 126704852) is (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine.
What is the SMILES notation for (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine?
The canonical SMILES for (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine is CN1CC[C@@](C)(c2cc3ccccc3s2)C1.
What is the InChIKey of (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine?
The InChIKey is GRBXYCWHHUSDDI-CQSZACIVSA-N. The full InChI is InChI=1S/C14H17NS/c1-14(7-8-15(2)10-14)13-9-11-5-3-4-6-12(11)16-13/h3-6,9H,7-8,10H2,1-2H3/t14-/m1/s1.
What are the key properties of (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine?
(3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine has a molecular weight of 231.36 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(1-benzothiophen-2-yl)-1,3-dimethylpyrrolidine is sourced from PubChem (CID 126704852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).