C17H20N2OS — CID 10424894
1-[1-(1-benzothiophen-2-yl)cyclohexyl]imidazolidin-2-one (PubChem CID 10424894) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-[1-(1-benzothiophen-2-yl)cyclohexyl]imidazolidin-2-one.
| Compound Name | 1-[1-(1-benzothiophen-2-yl)cyclohexyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 10424894 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-[1-(1-benzothiophen-2-yl)cyclohexyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1C1(c2cc3ccccc3s2)CCCCC1 |
| InChI | InChI=1S/C17H20N2OS/c20-16-18-10-11-19(16)17(8-4-1-5-9-17)15-12-13-6-2-3-7-14(13)21-15/h2-3,6-7,12H,1,4-5,8-11H2,(H,18,20) |
| InChIKey | TXGVKKIDVAHEDJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |