About 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine
1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine (PubChem CID 10245081) has the molecular formula C20H27NS
and a molecular weight of 313.51 g/mol. Its IUPAC name is 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine.
Molecular Properties
| Compound Name | 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine |
| PubChem CID | 10245081 |
| Molecular Formula | C20H27NS |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine |
| SMILES | C[C@H]1CCC[C@](c2cc3ccccc3s2)(N2CCCCC2)C1 |
| InChI | InChI=1S/C20H27NS/c1-16-8-7-11-20(15-16,21-12-5-2-6-13-21)19-14-17-9-3-4-10-18(17)22-19/h3-4,9-10,14,16H,2,5-8,11-13,15H2,1H3/t16-,20-/m0/s1 |
| InChIKey | PSRDBELHFNMTRV-JXFKEZNVSA-N |
| XLogP | 5.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine?
The IUPAC name of 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine (CID 10245081) is 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine.
What is the SMILES notation for 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine?
The canonical SMILES for 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine is C[C@H]1CCC[C@](c2cc3ccccc3s2)(N2CCCCC2)C1.
What is the InChIKey of 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine?
The InChIKey is PSRDBELHFNMTRV-JXFKEZNVSA-N. The full InChI is InChI=1S/C20H27NS/c1-16-8-7-11-20(15-16,21-12-5-2-6-13-21)19-14-17-9-3-4-10-18(17)22-19/h3-4,9-10,14,16H,2,5-8,11-13,15H2,1H3/t16-,20-/m0/s1.
What are the key properties of 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine?
1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine has a molecular weight of 313.51 g/mol, XLogP of 5.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,3S)-1-(1-benzothiophen-2-yl)-3-methylcyclohexyl]piperidine is sourced from PubChem (CID 10245081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).