C22H29NO2S — CID 10429320
[1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidin-3-yl]methyl acetate (PubChem CID 10429320) has the molecular formula C22H29NO2S and a molecular weight of 371.55 g/mol. Its IUPAC name is [1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidin-3-yl]methyl acetate.
| Compound Name | [1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 10429320 |
| Molecular Formula | C22H29NO2S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | [1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidin-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1CCCN(C2(c3cc4ccccc4s3)CCCCC2)C1 |
| InChI | InChI=1S/C22H29NO2S/c1-17(24)25-16-18-8-7-13-23(15-18)22(11-5-2-6-12-22)21-14-19-9-3-4-10-20(19)26-21/h3-4,9-10,14,18H,2,5-8,11-13,15-16H2,1H3 |
| InChIKey | KQWLYUUJYNUUID-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |