C15H18O4 — CID 11687566
ethyl (1R,5R)-7,7-diethynyl-5-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 11687566) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is ethyl (1R,5R)-7,7-diethynyl-5-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | ethyl (1R,5R)-7,7-diethynyl-5-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 11687566 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | ethyl (1R,5R)-7,7-diethynyl-5-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | C#CC1(C#C)O[C@]2(CO)CCC[C@@]1(C(=O)OCC)C2 |
| InChI | InChI=1S/C15H18O4/c1-4-15(5-2)14(12(17)18-6-3)9-7-8-13(10-14,11-16)19-15/h1-2,16H,6-11H2,3H3/t13-,14+/m1/s1 |
| InChIKey | WBOVUGRNDZQCPY-KGLIPLIRSA-N |
| XLogP | 0.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|