C10H10ClN3S — CID 116877436
2-(azetidin-3-yl)-5-(5-chlorothiophen-2-yl)-1H-imidazole (PubChem CID 116877436) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-5-(5-chlorothiophen-2-yl)-1H-imidazole.
| Compound Name | 2-(azetidin-3-yl)-5-(5-chlorothiophen-2-yl)-1H-imidazole |
|---|---|
| PubChem CID | 116877436 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 2-(azetidin-3-yl)-5-(5-chlorothiophen-2-yl)-1H-imidazole |
| SMILES | Clc1ccc(-c2cnc(C3CNC3)[nH]2)s1 |
| InChI | InChI=1S/C10H10ClN3S/c11-9-2-1-8(15-9)7-5-13-10(14-7)6-3-12-4-6/h1-2,5-6,12H,3-4H2,(H,13,14) |
| InChIKey | HSJVEECTNAMPNJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |