C12H13N3O2 — CID 116878820
3-(5-pyridin-3-yl-1H-imidazol-2-yl)butanoic acid (PubChem CID 116878820) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-(5-pyridin-3-yl-1H-imidazol-2-yl)butanoic acid.
| Compound Name | 3-(5-pyridin-3-yl-1H-imidazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 116878820 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 3-(5-pyridin-3-yl-1H-imidazol-2-yl)butanoic acid |
| SMILES | CC(CC(=O)O)c1ncc(-c2cccnc2)[nH]1 |
| InChI | InChI=1S/C12H13N3O2/c1-8(5-11(16)17)12-14-7-10(15-12)9-3-2-4-13-6-9/h2-4,6-8H,5H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | JXAOAVUCLRSLCN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |