C20H20N4O — CID 95304316
(E)-N-[(1R)-1-(5-phenyl-1H-imidazol-2-yl)propyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 95304316) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(5-phenyl-1H-imidazol-2-yl)propyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(5-phenyl-1H-imidazol-2-yl)propyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 95304316 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (E)-N-[(1R)-1-(5-phenyl-1H-imidazol-2-yl)propyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CC[C@@H](NC(=O)/C=C/c1cccnc1)c1ncc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C20H20N4O/c1-2-17(23-19(25)11-10-15-7-6-12-21-13-15)20-22-14-18(24-20)16-8-4-3-5-9-16/h3-14,17H,2H2,1H3,(H,22,24)(H,23,25)/b11-10+/t17-/m1/s1 |
| InChIKey | KPYVDSMFFBMEEE-SXSDINLZSA-N |
| XLogP | 3.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|