C11H12N2O4 — CID 80750784
(2R)-3-hydroxy-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]propanoic acid (PubChem CID 80750784) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 80750784 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (2R)-3-hydroxy-2-[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]propanoic acid |
| SMILES | O=C(/C=C/c1cccnc1)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C11H12N2O4/c14-7-9(11(16)17)13-10(15)4-3-8-2-1-5-12-6-8/h1-6,9,14H,7H2,(H,13,15)(H,16,17)/b4-3+/t9-/m1/s1 |
| InChIKey | AMTOGGKNVWYWII-CDAZIORVSA-N |
| XLogP | -0.34 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|