C14H14BrN3 — CID 116880575
2-[5-(5-bromo-2-methylphenyl)-1H-imidazol-2-yl]-2-methylpropanenitrile (PubChem CID 116880575) has the molecular formula C14H14BrN3 and a molecular weight of 304.19 g/mol. Its IUPAC name is 2-[5-(5-bromo-2-methylphenyl)-1H-imidazol-2-yl]-2-methylpropanenitrile.
| Compound Name | 2-[5-(5-bromo-2-methylphenyl)-1H-imidazol-2-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 116880575 |
| Molecular Formula | C14H14BrN3 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-[5-(5-bromo-2-methylphenyl)-1H-imidazol-2-yl]-2-methylpropanenitrile |
| SMILES | Cc1ccc(Br)cc1-c1cnc(C(C)(C)C#N)[nH]1 |
| InChI | InChI=1S/C14H14BrN3/c1-9-4-5-10(15)6-11(9)12-7-17-13(18-12)14(2,3)8-16/h4-7H,1-3H3,(H,17,18) |
| InChIKey | YONJPKLSIRSGFS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |