C14H15BrN2O2 — CID 116882782
2-[5-(5-bromo-2-methylphenyl)-1H-imidazol-2-yl]butanoic acid (PubChem CID 116882782) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 2-[5-(5-bromo-2-methylphenyl)-1H-imidazol-2-yl]butanoic acid.
| Compound Name | 2-[5-(5-bromo-2-methylphenyl)-1H-imidazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 116882782 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-[5-(5-bromo-2-methylphenyl)-1H-imidazol-2-yl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ncc(-c2cc(Br)ccc2C)[nH]1 |
| InChI | InChI=1S/C14H15BrN2O2/c1-3-10(14(18)19)13-16-7-12(17-13)11-6-9(15)5-4-8(11)2/h4-7,10H,3H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | GRBMXJYNOCKFIE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |