C21H28F3N3O2 — CID 58724966
(3S)-3-amino-3-[5-[4-heptyl-3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]butanoic acid (PubChem CID 58724966) has the molecular formula C21H28F3N3O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is (3S)-3-amino-3-[5-[4-heptyl-3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]butanoic acid.
| Compound Name | (3S)-3-amino-3-[5-[4-heptyl-3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 58724966 |
| Molecular Formula | C21H28F3N3O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | (3S)-3-amino-3-[5-[4-heptyl-3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]butanoic acid |
| SMILES | CCCCCCCc1ccc(-c2cnc([C@@](C)(N)CC(=O)O)[nH]2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H28F3N3O2/c1-3-4-5-6-7-8-14-9-10-15(11-16(14)21(22,23)24)17-13-26-19(27-17)20(2,25)12-18(28)29/h9-11,13H,3-8,12,25H2,1-2H3,(H,26,27)(H,28,29)/t20-/m0/s1 |
| InChIKey | ZLKIOXLNUJHVAD-FQEVSTJZSA-N |
| XLogP | 5.26 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|