C12H15BrN4S — CID 116881125
3-[5-(4-bromothiophen-2-yl)-1H-imidazol-2-yl]-1-methylpiperazine (PubChem CID 116881125) has the molecular formula C12H15BrN4S and a molecular weight of 327.25 g/mol. Its IUPAC name is 3-[5-(4-bromothiophen-2-yl)-1H-imidazol-2-yl]-1-methylpiperazine.
| Compound Name | 3-[5-(4-bromothiophen-2-yl)-1H-imidazol-2-yl]-1-methylpiperazine |
|---|---|
| PubChem CID | 116881125 |
| Molecular Formula | C12H15BrN4S |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3-[5-(4-bromothiophen-2-yl)-1H-imidazol-2-yl]-1-methylpiperazine |
| SMILES | CN1CCNC(c2ncc(-c3cc(Br)cs3)[nH]2)C1 |
| InChI | InChI=1S/C12H15BrN4S/c1-17-3-2-14-10(6-17)12-15-5-9(16-12)11-4-8(13)7-18-11/h4-5,7,10,14H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | KDXLISRWMASXBN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |