C20H29NO2 — CID 11688261
N-(cyclohexylmethyl)-N-[(1S,2S)-2-hydroxycyclohexyl]benzamide (PubChem CID 11688261) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-[(1S,2S)-2-hydroxycyclohexyl]benzamide.
| Compound Name | N-(cyclohexylmethyl)-N-[(1S,2S)-2-hydroxycyclohexyl]benzamide |
|---|---|
| PubChem CID | 11688261 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | N-(cyclohexylmethyl)-N-[(1S,2S)-2-hydroxycyclohexyl]benzamide |
| SMILES | O=C(c1ccccc1)N(CC1CCCCC1)[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C20H29NO2/c22-19-14-8-7-13-18(19)21(15-16-9-3-1-4-10-16)20(23)17-11-5-2-6-12-17/h2,5-6,11-12,16,18-19,22H,1,3-4,7-10,13-15H2/t18-,19-/m0/s1 |
| InChIKey | RZRDAWFUPACGDC-OALUTQOASA-N |
| XLogP | 4.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |