C20H23NO2 — CID 27245407
N-[(1S,2R)-2-hydroxycyclohexyl]-N-methyl-4-phenylbenzamide (PubChem CID 27245407) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxycyclohexyl]-N-methyl-4-phenylbenzamide.
| Compound Name | N-[(1S,2R)-2-hydroxycyclohexyl]-N-methyl-4-phenylbenzamide |
|---|---|
| PubChem CID | 27245407 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-[(1S,2R)-2-hydroxycyclohexyl]-N-methyl-4-phenylbenzamide |
| SMILES | CN(C(=O)c1ccc(-c2ccccc2)cc1)[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C20H23NO2/c1-21(18-9-5-6-10-19(18)22)20(23)17-13-11-16(12-14-17)15-7-3-2-4-8-15/h2-4,7-8,11-14,18-19,22H,5-6,9-10H2,1H3/t18-,19+/m0/s1 |
| InChIKey | SVPDYELOYLXYBO-RBUKOAKNSA-N |
| XLogP | 3.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |