C13H13FN2O2 — CID 116882683
[3-[5-(3-fluorophenyl)-1H-imidazol-2-yl]oxetan-3-yl]methanol (PubChem CID 116882683) has the molecular formula C13H13FN2O2 and a molecular weight of 248.26 g/mol. Its IUPAC name is [3-[5-(3-fluorophenyl)-1H-imidazol-2-yl]oxetan-3-yl]methanol.
| Compound Name | [3-[5-(3-fluorophenyl)-1H-imidazol-2-yl]oxetan-3-yl]methanol |
|---|---|
| PubChem CID | 116882683 |
| Molecular Formula | C13H13FN2O2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | [3-[5-(3-fluorophenyl)-1H-imidazol-2-yl]oxetan-3-yl]methanol |
| SMILES | OCC1(c2ncc(-c3cccc(F)c3)[nH]2)COC1 |
| InChI | InChI=1S/C13H13FN2O2/c14-10-3-1-2-9(4-10)11-5-15-12(16-11)13(6-17)7-18-8-13/h1-5,17H,6-8H2,(H,15,16) |
| InChIKey | DCUKNSZSHDADSE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |