C15H20N2O — CID 116882858
2-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]butan-1-ol (PubChem CID 116882858) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]butan-1-ol.
| Compound Name | 2-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 116882858 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]butan-1-ol |
| SMILES | CCC(CO)c1ncc(-c2ccc(C)cc2C)[nH]1 |
| InChI | InChI=1S/C15H20N2O/c1-4-12(9-18)15-16-8-14(17-15)13-6-5-10(2)7-11(13)3/h5-8,12,18H,4,9H2,1-3H3,(H,16,17) |
| InChIKey | HKUAMQKMAPBLMA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |