C10H11N3O2S — CID 116883394
2-(methylamino)-2-(5-thiophen-2-yl-1H-imidazol-2-yl)acetic acid (PubChem CID 116883394) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-(methylamino)-2-(5-thiophen-2-yl-1H-imidazol-2-yl)acetic acid.
| Compound Name | 2-(methylamino)-2-(5-thiophen-2-yl-1H-imidazol-2-yl)acetic acid |
|---|---|
| PubChem CID | 116883394 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-(methylamino)-2-(5-thiophen-2-yl-1H-imidazol-2-yl)acetic acid |
| SMILES | CNC(C(=O)O)c1ncc(-c2cccs2)[nH]1 |
| InChI | InChI=1S/C10H11N3O2S/c1-11-8(10(14)15)9-12-5-6(13-9)7-3-2-4-16-7/h2-5,8,11H,1H3,(H,12,13)(H,14,15) |
| InChIKey | SCVXIZPYPHBAOM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |