C16H12N6O2S2 — CID 59363932
N,N'-bis(4-thiophen-2-yl-1H-pyrazol-5-yl)oxamide (PubChem CID 59363932) has the molecular formula C16H12N6O2S2 and a molecular weight of 384.45 g/mol. Its IUPAC name is N,N'-bis(4-thiophen-2-yl-1H-pyrazol-5-yl)oxamide.
| Compound Name | N,N'-bis(4-thiophen-2-yl-1H-pyrazol-5-yl)oxamide |
|---|---|
| PubChem CID | 59363932 |
| Molecular Formula | C16H12N6O2S2 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N,N'-bis(4-thiophen-2-yl-1H-pyrazol-5-yl)oxamide |
| SMILES | O=C(Nc1[nH]ncc1-c1cccs1)C(=O)Nc1[nH]ncc1-c1cccs1 |
| InChI | InChI=1S/C16H12N6O2S2/c23-15(19-13-9(7-17-21-13)11-3-1-5-25-11)16(24)20-14-10(8-18-22-14)12-4-2-6-26-12/h1-8H,(H2,17,19,21,23)(H2,18,20,22,24) |
| InChIKey | XEKHTNMCOQQWTQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|