C17H23FN2OS — CID 11688373
[1-(3-fluoro-4-methylphenyl)piperidin-4-yl]-thiomorpholin-4-ylmethanone (PubChem CID 11688373) has the molecular formula C17H23FN2OS and a molecular weight of 322.45 g/mol. Its IUPAC name is [1-(3-fluoro-4-methylphenyl)piperidin-4-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [1-(3-fluoro-4-methylphenyl)piperidin-4-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 11688373 |
| Molecular Formula | C17H23FN2OS |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [1-(3-fluoro-4-methylphenyl)piperidin-4-yl]-thiomorpholin-4-ylmethanone |
| SMILES | Cc1ccc(N2CCC(C(=O)N3CCSCC3)CC2)cc1F |
| InChI | InChI=1S/C17H23FN2OS/c1-13-2-3-15(12-16(13)18)19-6-4-14(5-7-19)17(21)20-8-10-22-11-9-20/h2-3,12,14H,4-11H2,1H3 |
| InChIKey | BBVCPBUWASMVBQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |