C8H12N2O2S — CID 116886647
2-amino-2-(2-ethyl-4-methyl-1,3-thiazol-5-yl)acetic acid (PubChem CID 116886647) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 2-amino-2-(2-ethyl-4-methyl-1,3-thiazol-5-yl)acetic acid.
| Compound Name | 2-amino-2-(2-ethyl-4-methyl-1,3-thiazol-5-yl)acetic acid |
|---|---|
| PubChem CID | 116886647 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-amino-2-(2-ethyl-4-methyl-1,3-thiazol-5-yl)acetic acid |
| SMILES | CCc1nc(C)c(C(N)C(=O)O)s1 |
| InChI | InChI=1S/C8H12N2O2S/c1-3-5-10-4(2)7(13-5)6(9)8(11)12/h6H,3,9H2,1-2H3,(H,11,12) |
| InChIKey | WBCNHCGMAYFNTA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |