C9H12N2S — CID 116887293
2-(2,4-dimethyl-1,3-thiazol-5-yl)butanenitrile (PubChem CID 116887293) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-thiazol-5-yl)butanenitrile.
| Compound Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)butanenitrile |
|---|---|
| PubChem CID | 116887293 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)butanenitrile |
| SMILES | CCC(C#N)c1sc(C)nc1C |
| InChI | InChI=1S/C9H12N2S/c1-4-8(5-10)9-6(2)11-7(3)12-9/h8H,4H2,1-3H3 |
| InChIKey | OBDWKYXVMWWABZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |