C12H11NO2S2 — CID 116889667
2-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazole-4-thiol (PubChem CID 116889667) has the molecular formula C12H11NO2S2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazole-4-thiol.
| Compound Name | 2-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazole-4-thiol |
|---|---|
| PubChem CID | 116889667 |
| Molecular Formula | C12H11NO2S2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazole-4-thiol |
| SMILES | Cc1cc2c(cc1-c1nc(S)cs1)OCCO2 |
| InChI | InChI=1S/C12H11NO2S2/c1-7-4-9-10(15-3-2-14-9)5-8(7)12-13-11(16)6-17-12/h4-6,16H,2-3H2,1H3 |
| InChIKey | QEYNIVHPZRMWSF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 31.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|