C13H12N2S — CID 116889937
2-(2,4,5-trimethylphenyl)-1,3-thiazole-4-carbonitrile (PubChem CID 116889937) has the molecular formula C13H12N2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-(2,4,5-trimethylphenyl)-1,3-thiazole-4-carbonitrile.
| Compound Name | 2-(2,4,5-trimethylphenyl)-1,3-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 116889937 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-(2,4,5-trimethylphenyl)-1,3-thiazole-4-carbonitrile |
| SMILES | Cc1cc(C)c(-c2nc(C#N)cs2)cc1C |
| InChI | InChI=1S/C13H12N2S/c1-8-4-10(3)12(5-9(8)2)13-15-11(6-14)7-16-13/h4-5,7H,1-3H3 |
| InChIKey | VJNVAKDCHISLQV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |