C10H3IN4S3 — CID 146331597
2-[2-(2-iodo-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1,3-thiazole-4-carbonitrile (PubChem CID 146331597) has the molecular formula C10H3IN4S3 and a molecular weight of 402.27 g/mol. Its IUPAC name is 2-[2-(2-iodo-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1,3-thiazole-4-carbonitrile.
| Compound Name | 2-[2-(2-iodo-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1,3-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 146331597 |
| Molecular Formula | C10H3IN4S3 |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 401.86 |
| IUPAC Name | 2-[2-(2-iodo-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1,3-thiazole-4-carbonitrile |
| SMILES | N#Cc1csc(-c2csc(-c3csc(I)n3)n2)n1 |
| InChI | InChI=1S/C10H3IN4S3/c11-10-15-7(4-18-10)9-14-6(3-17-9)8-13-5(1-12)2-16-8/h2-4H |
| InChIKey | FTGIKHBFAFLZKF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|