C11H19N3S — CID 116891623
2-methyl-4-(2-piperazin-1-ylpropan-2-yl)-1,3-thiazole (PubChem CID 116891623) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-methyl-4-(2-piperazin-1-ylpropan-2-yl)-1,3-thiazole.
| Compound Name | 2-methyl-4-(2-piperazin-1-ylpropan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 116891623 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-methyl-4-(2-piperazin-1-ylpropan-2-yl)-1,3-thiazole |
| SMILES | Cc1nc(C(C)(C)N2CCNCC2)cs1 |
| InChI | InChI=1S/C11H19N3S/c1-9-13-10(8-15-9)11(2,3)14-6-4-12-5-7-14/h8,12H,4-7H2,1-3H3 |
| InChIKey | MKHDYFJFSSNLSC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |