C18H24F3N5OS — CID 142065869
4-(2-piperazin-1-ylpropan-2-yl)-2-pyridin-3-yl-1,3-thiazole;N-(2,2,2-trifluoroethyl)formamide (PubChem CID 142065869) has the molecular formula C18H24F3N5OS and a molecular weight of 415.49 g/mol. Its IUPAC name is 4-(2-piperazin-1-ylpropan-2-yl)-2-pyridin-3-yl-1,3-thiazole;N-(2,2,2-trifluoroethyl)formamide.
| Compound Name | 4-(2-piperazin-1-ylpropan-2-yl)-2-pyridin-3-yl-1,3-thiazole;N-(2,2,2-trifluoroethyl)formamide |
|---|---|
| PubChem CID | 142065869 |
| Molecular Formula | C18H24F3N5OS |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-(2-piperazin-1-ylpropan-2-yl)-2-pyridin-3-yl-1,3-thiazole;N-(2,2,2-trifluoroethyl)formamide |
| SMILES | CC(C)(c1csc(-c2cccnc2)n1)N1CCNCC1.O=CNCC(F)(F)F |
| InChI | InChI=1S/C15H20N4S.C3H4F3NO/c1-15(2,19-8-6-16-7-9-19)13-11-20-14(18-13)12-4-3-5-17-10-12;4-3(5,6)1-7-2-8/h3-5,10-11,16H,6-9H2,1-2H3;2H,1H2,(H,7,8) |
| InChIKey | JNCVKRFKQASUTD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|