C21H30F3N5O2 — CID 142065690
2-(2-piperazin-1-ylpropan-2-yl)-5-(5-propyl-3-pyridinyl)-1,3-oxazole;N-(2,2,2-trifluoroethyl)formamide (PubChem CID 142065690) has the molecular formula C21H30F3N5O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is 2-(2-piperazin-1-ylpropan-2-yl)-5-(5-propyl-3-pyridinyl)-1,3-oxazole;N-(2,2,2-trifluoroethyl)formamide.
| Compound Name | 2-(2-piperazin-1-ylpropan-2-yl)-5-(5-propyl-3-pyridinyl)-1,3-oxazole;N-(2,2,2-trifluoroethyl)formamide |
|---|---|
| PubChem CID | 142065690 |
| Molecular Formula | C21H30F3N5O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 2-(2-piperazin-1-ylpropan-2-yl)-5-(5-propyl-3-pyridinyl)-1,3-oxazole;N-(2,2,2-trifluoroethyl)formamide |
| SMILES | CCCc1cncc(-c2cnc(C(C)(C)N3CCNCC3)o2)c1.O=CNCC(F)(F)F |
| InChI | InChI=1S/C18H26N4O.C3H4F3NO/c1-4-5-14-10-15(12-20-11-14)16-13-21-17(23-16)18(2,3)22-8-6-19-7-9-22;4-3(5,6)1-7-2-8/h10-13,19H,4-9H2,1-3H3;2H,1H2,(H,7,8) |
| InChIKey | RMHLXRVAOHUUGA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|