C19H28F2N4O2 — CID 142065897
N-(1,3-difluoro-2-methylpropan-2-yl)formamide;2-(2-piperazin-1-ylpropan-2-yl)furo[3,2-c]pyridine (PubChem CID 142065897) has the molecular formula C19H28F2N4O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-(1,3-difluoro-2-methylpropan-2-yl)formamide;2-(2-piperazin-1-ylpropan-2-yl)furo[3,2-c]pyridine.
| Compound Name | N-(1,3-difluoro-2-methylpropan-2-yl)formamide;2-(2-piperazin-1-ylpropan-2-yl)furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 142065897 |
| Molecular Formula | C19H28F2N4O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | N-(1,3-difluoro-2-methylpropan-2-yl)formamide;2-(2-piperazin-1-ylpropan-2-yl)furo[3,2-c]pyridine |
| SMILES | CC(C)(c1cc2cnccc2o1)N1CCNCC1.CC(CF)(CF)NC=O |
| InChI | InChI=1S/C14H19N3O.C5H9F2NO/c1-14(2,17-7-5-15-6-8-17)13-9-11-10-16-4-3-12(11)18-13;1-5(2-6,3-7)8-4-9/h3-4,9-10,15H,5-8H2,1-2H3;4H,2-3H2,1H3,(H,8,9) |
| InChIKey | SSTGHGQMYNFVFQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|