About furo[3,2-c]pyridine-2-thiol
furo[3,2-c]pyridine-2-thiol (PubChem CID 123607064) has the molecular formula C7H5NOS
and a molecular weight of 151.19 g/mol. Its IUPAC name is furo[3,2-c]pyridine-2-thiol.
Molecular Properties
| Compound Name | furo[3,2-c]pyridine-2-thiol |
| PubChem CID | 123607064 |
| Molecular Formula | C7H5NOS |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.01 |
| IUPAC Name | furo[3,2-c]pyridine-2-thiol |
| SMILES | Sc1cc2cnccc2o1 |
| InChI | InChI=1S/C7H5NOS/c10-7-3-5-4-8-2-1-6(5)9-7/h1-4,10H |
| InChIKey | XKCVARXLDCGHBM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze furo[3,2-c]pyridine-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-c]pyridine-2-thiol?
The IUPAC name of furo[3,2-c]pyridine-2-thiol (CID 123607064) is furo[3,2-c]pyridine-2-thiol.
What is the SMILES notation for furo[3,2-c]pyridine-2-thiol?
The canonical SMILES for furo[3,2-c]pyridine-2-thiol is Sc1cc2cnccc2o1.
What is the InChIKey of furo[3,2-c]pyridine-2-thiol?
The InChIKey is XKCVARXLDCGHBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NOS/c10-7-3-5-4-8-2-1-6(5)9-7/h1-4,10H.
What are the key properties of furo[3,2-c]pyridine-2-thiol?
furo[3,2-c]pyridine-2-thiol has a molecular weight of 151.19 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-c]pyridine-2-thiol is sourced from PubChem (CID 123607064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).